C15H29F2NO — CID 123891794
N-tert-butyl-2-(4,4-difluoro-5-methylhex-2-enoxy)-2-methylpropan-1-amine (PubChem CID 123891794) has the molecular formula C15H29F2NO and a molecular weight of 277.40 g/mol. Its IUPAC name is N-tert-butyl-2-(4,4-difluoro-5-methylhex-2-enoxy)-2-methylpropan-1-amine.
| Compound Name | N-tert-butyl-2-(4,4-difluoro-5-methylhex-2-enoxy)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 123891794 |
| Molecular Formula | C15H29F2NO |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N-tert-butyl-2-(4,4-difluoro-5-methylhex-2-enoxy)-2-methylpropan-1-amine |
| SMILES | CC(C)C(F)(F)C=CCOC(C)(C)CNC(C)(C)C |
| InChI | InChI=1S/C15H29F2NO/c1-12(2)15(16,17)9-8-10-19-14(6,7)11-18-13(3,4)5/h8-9,12,18H,10-11H2,1-7H3 |
| InChIKey | ZVZCGOPLSJUTOD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|