About CID 123892667
CID 123892667 (PubChem CID 123892667) has the molecular formula C16H16BrF2N
and a molecular weight of 340.21 g/mol.
Molecular Properties
| Compound Name | CID 123892667 |
| PubChem CID | 123892667 |
| Molecular Formula | C16H16BrF2N |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | — |
| SMILES | FC(F)C1CCC2(CC1)Cc1ccc(Br)cc1C21C=N1 |
| InChI | InChI=1S/C16H16BrF2N/c17-12-2-1-11-8-15(16(9-20-16)13(11)7-12)5-3-10(4-6-15)14(18)19/h1-2,7,9-10,14H,3-6,8H2 |
| InChIKey | MAOHBIPQMUQVBZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 123892667 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123892667?
The IUPAC name of CID 123892667 (CID 123892667) is not available.
What is the SMILES notation for CID 123892667?
The canonical SMILES for CID 123892667 is FC(F)C1CCC2(CC1)Cc1ccc(Br)cc1C21C=N1.
What is the InChIKey of CID 123892667?
The InChIKey is MAOHBIPQMUQVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrF2N/c17-12-2-1-11-8-15(16(9-20-16)13(11)7-12)5-3-10(4-6-15)14(18)19/h1-2,7,9-10,14H,3-6,8H2.
What are the key properties of CID 123892667?
CID 123892667 has a molecular weight of 340.21 g/mol, XLogP of 4.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123892667 is sourced from PubChem (CID 123892667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).