About 5'-bromospiro[cyclopropane-1,3'-indole]
5'-bromospiro[cyclopropane-1,3'-indole] (PubChem CID 154287958) has the molecular formula C10H8BrN
and a molecular weight of 222.09 g/mol. Its IUPAC name is 5'-bromospiro[cyclopropane-1,3'-indole].
Molecular Properties
| Compound Name | 5'-bromospiro[cyclopropane-1,3'-indole] |
| PubChem CID | 154287958 |
| Molecular Formula | C10H8BrN |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 5'-bromospiro[cyclopropane-1,3'-indole] |
| SMILES | Brc1ccc2c(c1)C1(C=N2)CC1 |
| InChI | InChI=1S/C10H8BrN/c11-7-1-2-9-8(5-7)10(3-4-10)6-12-9/h1-2,5-6H,3-4H2 |
| InChIKey | NYOBKCKKYWQODG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5'-bromospiro[cyclopropane-1,3'-indole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-bromospiro[cyclopropane-1,3'-indole]?
The IUPAC name of 5'-bromospiro[cyclopropane-1,3'-indole] (CID 154287958) is 5'-bromospiro[cyclopropane-1,3'-indole].
What is the SMILES notation for 5'-bromospiro[cyclopropane-1,3'-indole]?
The canonical SMILES for 5'-bromospiro[cyclopropane-1,3'-indole] is Brc1ccc2c(c1)C1(C=N2)CC1.
What is the InChIKey of 5'-bromospiro[cyclopropane-1,3'-indole]?
The InChIKey is NYOBKCKKYWQODG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrN/c11-7-1-2-9-8(5-7)10(3-4-10)6-12-9/h1-2,5-6H,3-4H2.
What are the key properties of 5'-bromospiro[cyclopropane-1,3'-indole]?
5'-bromospiro[cyclopropane-1,3'-indole] has a molecular weight of 222.09 g/mol, XLogP of 3.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-bromospiro[cyclopropane-1,3'-indole] is sourced from PubChem (CID 154287958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).