C14H14BrNO — CID 164582704
5'-bromo-2'-methylspiro[cyclohexane-4,3'-indole]-1-one (PubChem CID 164582704) has the molecular formula C14H14BrNO and a molecular weight of 292.18 g/mol. Its IUPAC name is 5'-bromo-2'-methylspiro[cyclohexane-4,3'-indole]-1-one.
| Compound Name | 5'-bromo-2'-methylspiro[cyclohexane-4,3'-indole]-1-one |
|---|---|
| PubChem CID | 164582704 |
| Molecular Formula | C14H14BrNO |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 5'-bromo-2'-methylspiro[cyclohexane-4,3'-indole]-1-one |
| SMILES | CC1=Nc2ccc(Br)cc2C12CCC(=O)CC2 |
| InChI | InChI=1S/C14H14BrNO/c1-9-14(6-4-11(17)5-7-14)12-8-10(15)2-3-13(12)16-9/h2-3,8H,4-7H2,1H3 |
| InChIKey | VXTIBZFOGKLXPZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |