C14H16BrNO — CID 91492565
5-(4-bromophenyl)imino-3,3-dimethylcyclohexan-1-one (PubChem CID 91492565) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is 5-(4-bromophenyl)imino-3,3-dimethylcyclohexan-1-one.
| Compound Name | 5-(4-bromophenyl)imino-3,3-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 91492565 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 5-(4-bromophenyl)imino-3,3-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C/C(=N\c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C14H16BrNO/c1-14(2)8-12(7-13(17)9-14)16-11-5-3-10(15)4-6-11/h3-6H,7-9H2,1-2H3/b16-12+ |
| InChIKey | JBMLFYKPKBIUHO-FOWTUZBSSA-N |
| XLogP | 4.30 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|