C5H13N3 — CID 123893474
2,3-dimethylimidazolidin-1-amine (PubChem CID 123893474) has the molecular formula C5H13N3 and a molecular weight of 115.18 g/mol. Its IUPAC name is 2,3-dimethylimidazolidin-1-amine.
| Compound Name | 2,3-dimethylimidazolidin-1-amine |
|---|---|
| PubChem CID | 123893474 |
| Molecular Formula | C5H13N3 |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | 2,3-dimethylimidazolidin-1-amine |
| SMILES | CC1N(C)CCN1N |
| InChI | InChI=1S/C5H13N3/c1-5-7(2)3-4-8(5)6/h5H,3-4,6H2,1-2H3 |
| InChIKey | AUJUFOYSJGWCLY-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|