C7H18N3+ — CID 175539257
N,N,1,3-tetramethylimidazolidin-1-ium-1-amine (PubChem CID 175539257) has the molecular formula C7H18N3+ and a molecular weight of 144.24 g/mol. Its IUPAC name is N,N,1,3-tetramethylimidazolidin-1-ium-1-amine.
| Compound Name | N,N,1,3-tetramethylimidazolidin-1-ium-1-amine |
|---|---|
| PubChem CID | 175539257 |
| Molecular Formula | C7H18N3+ |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.15 |
| IUPAC Name | N,N,1,3-tetramethylimidazolidin-1-ium-1-amine |
| SMILES | CN1CC[N+](C)(N(C)C)C1 |
| InChI | InChI=1S/C7H18N3/c1-8(2)10(4)6-5-9(3)7-10/h5-7H2,1-4H3/q+1 |
| InChIKey | LPMMXATWXLMNRV-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|