About CID 59923857
CID 59923857 (PubChem CID 59923857) has the molecular formula C6H14N3
and a molecular weight of 128.20 g/mol.
Molecular Properties
| Compound Name | CID 59923857 |
| PubChem CID | 59923857 |
| Molecular Formula | C6H14N3 |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | — |
| SMILES | CC1N(C)[CH]N(C)N1C |
| InChI | InChI=1S/C6H14N3/c1-6-7(2)5-8(3)9(6)4/h5-6H,1-4H3 |
| InChIKey | BTPWNAZGTVGRBO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 59923857 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59923857?
The IUPAC name of CID 59923857 (CID 59923857) is not available.
What is the SMILES notation for CID 59923857?
The canonical SMILES for CID 59923857 is CC1N(C)[CH]N(C)N1C.
What is the InChIKey of CID 59923857?
The InChIKey is BTPWNAZGTVGRBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N3/c1-6-7(2)5-8(3)9(6)4/h5-6H,1-4H3.
What are the key properties of CID 59923857?
CID 59923857 has a molecular weight of 128.20 g/mol, XLogP of 0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59923857 is sourced from PubChem (CID 59923857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).