C6H15N3 — CID 123979649
1-ethyl-2,4-dimethyl-1,2,4-triazolidine (PubChem CID 123979649) has the molecular formula C6H15N3 and a molecular weight of 129.21 g/mol. Its IUPAC name is 1-ethyl-2,4-dimethyl-1,2,4-triazolidine.
| Compound Name | 1-ethyl-2,4-dimethyl-1,2,4-triazolidine |
|---|---|
| PubChem CID | 123979649 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 1-ethyl-2,4-dimethyl-1,2,4-triazolidine |
| SMILES | CCN1CN(C)CN1C |
| InChI | InChI=1S/C6H15N3/c1-4-9-6-7(2)5-8(9)3/h4-6H2,1-3H3 |
| InChIKey | GACDLSHHRXJWJP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |