C18H20F2N2O4S — CID 123895832
N-ethyl-7-fluoro-4-(4-fluorophenyl)sulfonyl-2-(methoxymethyl)-2,3-dihydro-1,4-benzoxazin-6-amine (PubChem CID 123895832) has the molecular formula C18H20F2N2O4S and a molecular weight of 398.43 g/mol. Its IUPAC name is N-ethyl-7-fluoro-4-(4-fluorophenyl)sulfonyl-2-(methoxymethyl)-2,3-dihydro-1,4-benzoxazin-6-amine.
| Compound Name | N-ethyl-7-fluoro-4-(4-fluorophenyl)sulfonyl-2-(methoxymethyl)-2,3-dihydro-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 123895832 |
| Molecular Formula | C18H20F2N2O4S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-ethyl-7-fluoro-4-(4-fluorophenyl)sulfonyl-2-(methoxymethyl)-2,3-dihydro-1,4-benzoxazin-6-amine |
| SMILES | CCNc1cc2c(cc1F)OC(COC)CN2S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20F2N2O4S/c1-3-21-16-9-17-18(8-15(16)20)26-13(11-25-2)10-22(17)27(23,24)14-6-4-12(19)5-7-14/h4-9,13,21H,3,10-11H2,1-2H3 |
| InChIKey | MDKMTBXBZAPIEL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|