C22H18F3N10O2+ — CID 123896134
N-[(5-methylfuran-2-yl)methyl]-8-[6-[[5-(trifluoromethyl)furan-2-yl]methylamino]-7H-purin-1-ium-1-yl]-7H-purin-6-amine (PubChem CID 123896134) has the molecular formula C22H18F3N10O2+ and a molecular weight of 511.45 g/mol. Its IUPAC name is N-[(5-methylfuran-2-yl)methyl]-8-[6-[[5-(trifluoromethyl)furan-2-yl]methylamino]-7H-purin-1-ium-1-yl]-7H-purin-6-amine.
| Compound Name | N-[(5-methylfuran-2-yl)methyl]-8-[6-[[5-(trifluoromethyl)furan-2-yl]methylamino]-7H-purin-1-ium-1-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 123896134 |
| Molecular Formula | C22H18F3N10O2+ |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | N-[(5-methylfuran-2-yl)methyl]-8-[6-[[5-(trifluoromethyl)furan-2-yl]methylamino]-7H-purin-1-ium-1-yl]-7H-purin-6-amine |
| SMILES | Cc1ccc(CNc2ncnc3nc(-[n+]4cnc5nc[nH]c5c4NCc4ccc(C(F)(F)F)o4)[nH]c23)o1 |
| InChI | InChI=1S/C22H17F3N10O2/c1-11-2-3-12(36-11)6-26-17-15-19(31-9-30-17)34-21(33-15)35-10-32-18-16(28-8-29-18)20(35)27-7-13-4-5-14(37-13)22(23,24)25/h2-5,8-10H,6-7H2,1H3,(H3,26,27,28,29,30,31,33,34)/p+1 |
| InChIKey | UVUDNRPRPZCJAE-UHFFFAOYSA-O |
| XLogP | 3.64 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|