C32H60 — CID 123897118
6-[1-(4-methylcyclohexyl)ethyl]-1-(6,7,10-trimethylundecan-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 123897118) has the molecular formula C32H60 and a molecular weight of 444.83 g/mol. Its IUPAC name is 6-[1-(4-methylcyclohexyl)ethyl]-1-(6,7,10-trimethylundecan-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 6-[1-(4-methylcyclohexyl)ethyl]-1-(6,7,10-trimethylundecan-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 123897118 |
| Molecular Formula | C32H60 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.47 |
| IUPAC Name | 6-[1-(4-methylcyclohexyl)ethyl]-1-(6,7,10-trimethylundecan-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CCC(CCC(C)C(C)CCC(C)C)C1CCC2CCC(C(C)C3CCC(C)CC3)CC21 |
| InChI | InChI=1S/C32H60/c1-8-27(16-13-25(6)24(5)12-9-22(2)3)31-20-19-29-17-18-30(21-32(29)31)26(7)28-14-10-23(4)11-15-28/h22-32H,8-21H2,1-7H3 |
| InChIKey | MABJPODGKCQTLS-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |