C14H28O2 — CID 67935409
(1S)-4-[(3R)-6-methylheptan-3-yl]cyclohexane-1,2-diol (PubChem CID 67935409) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is (1S)-4-[(3R)-6-methylheptan-3-yl]cyclohexane-1,2-diol.
| Compound Name | (1S)-4-[(3R)-6-methylheptan-3-yl]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 67935409 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | (1S)-4-[(3R)-6-methylheptan-3-yl]cyclohexane-1,2-diol |
| SMILES | CC[C@H](CCC(C)C)C1CC[C@H](O)C(O)C1 |
| InChI | InChI=1S/C14H28O2/c1-4-11(6-5-10(2)3)12-7-8-13(15)14(16)9-12/h10-16H,4-9H2,1-3H3/t11-,12?,13+,14?/m1/s1 |
| InChIKey | CEMSETATRKJPFX-ZIHBUVQPSA-N |
| XLogP | 2.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |