C17H32BNO4 — CID 174041474
CID 174041474 (PubChem CID 174041474) has the molecular formula C17H32BNO4 and a molecular weight of 325.26 g/mol.
| Compound Name | CID 174041474 |
|---|---|
| PubChem CID | 174041474 |
| Molecular Formula | C17H32BNO4 |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | — |
| SMILES | [B]C(C)C(N=O)C(OC(C)CCC(C)C)[C@@H]1CCC(O)C(O)C1 |
| InChI | InChI=1S/C17H32BNO4/c1-10(2)5-6-11(3)23-17(16(19-22)12(4)18)13-7-8-14(20)15(21)9-13/h10-17,20-21H,5-9H2,1-4H3/t11?,12?,13-,14?,15?,16?,17?/m1/s1 |
| InChIKey | HMVKIDWJHFLBIY-AVVBZMGYSA-N |
| XLogP | 2.83 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|