C14H29P — CID 155301887
1,2-dimethyl-5-(6-methylheptan-3-yl)phospholane (PubChem CID 155301887) has the molecular formula C14H29P and a molecular weight of 228.36 g/mol. Its IUPAC name is 1,2-dimethyl-5-(6-methylheptan-3-yl)phospholane.
| Compound Name | 1,2-dimethyl-5-(6-methylheptan-3-yl)phospholane |
|---|---|
| PubChem CID | 155301887 |
| Molecular Formula | C14H29P |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 1,2-dimethyl-5-(6-methylheptan-3-yl)phospholane |
| SMILES | CCC(CCC(C)C)C1CCC(C)P1C |
| InChI | InChI=1S/C14H29P/c1-6-13(9-7-11(2)3)14-10-8-12(4)15(14)5/h11-14H,6-10H2,1-5H3 |
| InChIKey | INHZAAGQBLMNML-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|