C11H23P — CID 146200751
2-methyl-1,5-di(propan-2-yl)phospholane (PubChem CID 146200751) has the molecular formula C11H23P and a molecular weight of 186.28 g/mol. Its IUPAC name is 2-methyl-1,5-di(propan-2-yl)phospholane.
| Compound Name | 2-methyl-1,5-di(propan-2-yl)phospholane |
|---|---|
| PubChem CID | 146200751 |
| Molecular Formula | C11H23P |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 2-methyl-1,5-di(propan-2-yl)phospholane |
| SMILES | CC(C)C1CCC(C)P1C(C)C |
| InChI | InChI=1S/C11H23P/c1-8(2)11-7-6-10(5)12(11)9(3)4/h8-11H,6-7H2,1-5H3 |
| InChIKey | OYGOMDQDSOXMMJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|