C30H40FeP2-8 — CID 172907917
bis((2S,5S)-1-cyclopenta-2,4-dien-1-yl-2,5-di(propan-2-yl)phospholane);iron(2+) (PubChem CID 172907917) has the molecular formula C30H40FeP2-8 and a molecular weight of 518.44 g/mol. Its IUPAC name is bis((2S,5S)-1-cyclopenta-2,4-dien-1-yl-2,5-di(propan-2-yl)phospholane);iron(2+).
| Compound Name | bis((2S,5S)-1-cyclopenta-2,4-dien-1-yl-2,5-di(propan-2-yl)phospholane);iron(2+) |
|---|---|
| PubChem CID | 172907917 |
| Molecular Formula | C30H40FeP2-8 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | bis((2S,5S)-1-cyclopenta-2,4-dien-1-yl-2,5-di(propan-2-yl)phospholane);iron(2+) |
| SMILES | CC(C)[C@@H]1CC[C@@H](C(C)C)P1[c-]1[c-][c-][c-][c-]1.CC(C)[C@@H]1CC[C@@H](C(C)C)P1[c-]1[c-][c-][c-][c-]1.[Fe+2] |
| InChI | InChI=1S/2C15H20P.Fe/c2*1-11(2)14-9-10-15(12(3)4)16(14)13-7-5-6-8-13;/h2*11-12,14-15H,9-10H2,1-4H3;/q2*-5;+2/t2*14-,15-;/m00./s1 |
| InChIKey | CVLSUGBLOSASLJ-XRLMYZCVSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|