C20H42P2 — CID 90716246
(2R,5R)-2,5-diethyl-1-methylphospholane;(2S,5S)-1-methyl-2,5-di(propan-2-yl)phospholane (PubChem CID 90716246) has the molecular formula C20H42P2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (2R,5R)-2,5-diethyl-1-methylphospholane;(2S,5S)-1-methyl-2,5-di(propan-2-yl)phospholane.
| Compound Name | (2R,5R)-2,5-diethyl-1-methylphospholane;(2S,5S)-1-methyl-2,5-di(propan-2-yl)phospholane |
|---|---|
| PubChem CID | 90716246 |
| Molecular Formula | C20H42P2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | (2R,5R)-2,5-diethyl-1-methylphospholane;(2S,5S)-1-methyl-2,5-di(propan-2-yl)phospholane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C(C)C)P1C.CC[C@@H]1CC[C@@H](CC)P1C |
| InChI | InChI=1S/C11H23P.C9H19P/c1-8(2)10-6-7-11(9(3)4)12(10)5;1-4-8-6-7-9(5-2)10(8)3/h8-11H,6-7H2,1-5H3;8-9H,4-7H2,1-3H3/t10-,11-;8-,9-/m01/s1 |
| InChIKey | DGYDQNWWQHPOHZ-CYVKKYGBSA-N |
| XLogP | 7.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|