C21H40P2 — CID 58900685
(2S,5S)-1-[2-[(2R,5R)-2,5-diethylphospholan-1-yl]cyclopentyl]-2,5-diethylphospholane (PubChem CID 58900685) has the molecular formula C21H40P2 and a molecular weight of 354.50 g/mol. Its IUPAC name is (2S,5S)-1-[2-[(2R,5R)-2,5-diethylphospholan-1-yl]cyclopentyl]-2,5-diethylphospholane.
| Compound Name | (2S,5S)-1-[2-[(2R,5R)-2,5-diethylphospholan-1-yl]cyclopentyl]-2,5-diethylphospholane |
|---|---|
| PubChem CID | 58900685 |
| Molecular Formula | C21H40P2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (2S,5S)-1-[2-[(2R,5R)-2,5-diethylphospholan-1-yl]cyclopentyl]-2,5-diethylphospholane |
| SMILES | CC[C@@H]1CC[C@@H](CC)P1C1CCCC1P1[C@@H](CC)CC[C@@H]1CC |
| InChI | InChI=1S/C21H40P2/c1-5-16-12-13-17(6-2)22(16)20-10-9-11-21(20)23-18(7-3)14-15-19(23)8-4/h16-21H,5-15H2,1-4H3/t16-,17-,18+,19+,20?,21? |
| InChIKey | UWOJWDCCDPSLHN-ZZXHIZJNSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|