C19H36P2 — CID 134577138
(2R,5R)-2,5-diethyl-1-[2-[(2R)-2-ethylphospholan-1-yl]cyclopentyl]phospholane (PubChem CID 134577138) has the molecular formula C19H36P2 and a molecular weight of 326.45 g/mol. Its IUPAC name is (2R,5R)-2,5-diethyl-1-[2-[(2R)-2-ethylphospholan-1-yl]cyclopentyl]phospholane.
| Compound Name | (2R,5R)-2,5-diethyl-1-[2-[(2R)-2-ethylphospholan-1-yl]cyclopentyl]phospholane |
|---|---|
| PubChem CID | 134577138 |
| Molecular Formula | C19H36P2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (2R,5R)-2,5-diethyl-1-[2-[(2R)-2-ethylphospholan-1-yl]cyclopentyl]phospholane |
| SMILES | CC[C@@H]1CCCP1C1CCCC1P1[C@H](CC)CC[C@H]1CC |
| InChI | InChI=1S/C19H36P2/c1-4-15-9-8-14-20(15)18-10-7-11-19(18)21-16(5-2)12-13-17(21)6-3/h15-19H,4-14H2,1-3H3/t15-,16-,17-,18?,19?,20?/m1/s1 |
| InChIKey | ZPCCTUVBEDNJPP-DVXZDJFESA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|