C16H32P2 — CID 158209000
(1R,2R)-1-tert-butyl-2-[(1R)-1-tert-butylphospholan-2-yl]phospholane (PubChem CID 158209000) has the molecular formula C16H32P2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (1R,2R)-1-tert-butyl-2-[(1R)-1-tert-butylphospholan-2-yl]phospholane.
| Compound Name | (1R,2R)-1-tert-butyl-2-[(1R)-1-tert-butylphospholan-2-yl]phospholane |
|---|---|
| PubChem CID | 158209000 |
| Molecular Formula | C16H32P2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (1R,2R)-1-tert-butyl-2-[(1R)-1-tert-butylphospholan-2-yl]phospholane |
| SMILES | CC(C)(C)[P@]1CCCC1[C@H]1CCC[P@@]1C(C)(C)C |
| InChI | InChI=1S/C16H32P2/c1-15(2,3)17-11-7-9-13(17)14-10-8-12-18(14)16(4,5)6/h13-14H,7-12H2,1-6H3/t13-,14?,17-,18-/m1/s1 |
| InChIKey | SJNUZTRUIDRSJK-HOEVYRDGSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|