C16H30P2 — CID 171560754
(2S,5S)-2,5-dimethyl-1-[(1R)-2-[(2S)-2-methylphospholan-1-yl]cyclopentyl]phospholane (PubChem CID 171560754) has the molecular formula C16H30P2 and a molecular weight of 284.36 g/mol. Its IUPAC name is (2S,5S)-2,5-dimethyl-1-[(1R)-2-[(2S)-2-methylphospholan-1-yl]cyclopentyl]phospholane.
| Compound Name | (2S,5S)-2,5-dimethyl-1-[(1R)-2-[(2S)-2-methylphospholan-1-yl]cyclopentyl]phospholane |
|---|---|
| PubChem CID | 171560754 |
| Molecular Formula | C16H30P2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (2S,5S)-2,5-dimethyl-1-[(1R)-2-[(2S)-2-methylphospholan-1-yl]cyclopentyl]phospholane |
| SMILES | C[C@H]1CCCP1C1CCC[C@H]1P1[C@@H](C)CC[C@@H]1C |
| InChI | InChI=1S/C16H30P2/c1-12-6-5-11-17(12)15-7-4-8-16(15)18-13(2)9-10-14(18)3/h12-16H,4-11H2,1-3H3/t12-,13-,14-,15?,16+,17?/m0/s1 |
| InChIKey | QJTHWFZVQVPBOZ-JKKVVXSLSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|