C22H42FeP2 — CID 155884997
bis((2S,5S)-1-cyclopentyl-2,5-dimethylphospholane);iron (PubChem CID 155884997) has the molecular formula C22H42FeP2 and a molecular weight of 424.37 g/mol. Its IUPAC name is bis((2S,5S)-1-cyclopentyl-2,5-dimethylphospholane);iron.
| Compound Name | bis((2S,5S)-1-cyclopentyl-2,5-dimethylphospholane);iron |
|---|---|
| PubChem CID | 155884997 |
| Molecular Formula | C22H42FeP2 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | bis((2S,5S)-1-cyclopentyl-2,5-dimethylphospholane);iron |
| SMILES | C[C@H]1CC[C@H](C)P1C1CCCC1.C[C@H]1CC[C@H](C)P1C1CCCC1.[Fe] |
| InChI | InChI=1S/2C11H21P.Fe/c2*1-9-7-8-10(2)12(9)11-5-3-4-6-11;/h2*9-11H,3-8H2,1-2H3;/t2*9-,10-;/m00./s1 |
| InChIKey | HMCOBQFHUYMJEN-VUTIHBPYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|