About 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold
2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold (PubChem CID 71340250) has the molecular formula C12H22AuClP
and a molecular weight of 429.70 g/mol. Its IUPAC name is 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold.
Molecular Properties
| Compound Name | 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold |
| PubChem CID | 71340250 |
| Molecular Formula | C12H22AuClP |
| Molecular Weight | 429.70 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold |
| SMILES | CC1CP(C2CCCCC2)C(Cl)C1C.[Au] |
| InChI | InChI=1S/C12H22ClP.Au/c1-9-8-14(12(13)10(9)2)11-6-4-3-5-7-11;/h9-12H,3-8H2,1-2H3; |
| InChIKey | IISSXOLGIIGGBS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold?
The IUPAC name of 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold (CID 71340250) is 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold.
What is the SMILES notation for 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold?
The canonical SMILES for 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold is CC1CP(C2CCCCC2)C(Cl)C1C.[Au].
What is the InChIKey of 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold?
The InChIKey is IISSXOLGIIGGBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22ClP.Au/c1-9-8-14(12(13)10(9)2)11-6-4-3-5-7-11;/h9-12H,3-8H2,1-2H3;.
What are the key properties of 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold?
2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold has a molecular weight of 429.70 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-cyclohexyl-3,4-dimethylphospholane;gold is sourced from PubChem (CID 71340250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).