C20H38P2 — CID 123179204
(2S,4S)-1-cyclopentyl-2,4-dimethylphosphetane (PubChem CID 123179204) has the molecular formula C20H38P2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (2S,4S)-1-cyclopentyl-2,4-dimethylphosphetane.
| Compound Name | (2S,4S)-1-cyclopentyl-2,4-dimethylphosphetane |
|---|---|
| PubChem CID | 123179204 |
| Molecular Formula | C20H38P2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (2S,4S)-1-cyclopentyl-2,4-dimethylphosphetane |
| SMILES | C[C@H]1C[C@H](C)P1C1CCCC1.C[C@H]1C[C@H](C)P1C1CCCC1 |
| InChI | InChI=1S/2C10H19P/c2*1-8-7-9(2)11(8)10-5-3-4-6-10/h2*8-10H,3-7H2,1-2H3/t2*8-,9-/m00/s1 |
| InChIKey | BPWUEMHYPHJBKQ-FFNHTDCDSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|