C17H32P2 — CID 139306014
(2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]cyclopentyl]-2,5-dimethylphospholane (PubChem CID 139306014) has the molecular formula C17H32P2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]cyclopentyl]-2,5-dimethylphospholane.
| Compound Name | (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]cyclopentyl]-2,5-dimethylphospholane |
|---|---|
| PubChem CID | 139306014 |
| Molecular Formula | C17H32P2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]cyclopentyl]-2,5-dimethylphospholane |
| SMILES | C[C@@H]1CC[C@@H](C)P1C1CCCC1P1[C@H](C)CC[C@H]1C |
| InChI | InChI=1S/C17H32P2/c1-12-8-9-13(2)18(12)16-6-5-7-17(16)19-14(3)10-11-15(19)4/h12-17H,5-11H2,1-4H3/t12-,13-,14-,15-,16?,17?/m1/s1 |
| InChIKey | AAQMAEIFZBBOPT-IIQOZLQZSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|