C13H25P — CID 91984020
1-cyclopentyl-2,5-diethylphospholane (PubChem CID 91984020) has the molecular formula C13H25P and a molecular weight of 212.32 g/mol. Its IUPAC name is 1-cyclopentyl-2,5-diethylphospholane.
| Compound Name | 1-cyclopentyl-2,5-diethylphospholane |
|---|---|
| PubChem CID | 91984020 |
| Molecular Formula | C13H25P |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | 1-cyclopentyl-2,5-diethylphospholane |
| SMILES | CCC1CCC(CC)P1C1CCCC1 |
| InChI | InChI=1S/C13H25P/c1-3-11-9-10-12(4-2)14(11)13-7-5-6-8-13/h11-13H,3-10H2,1-2H3 |
| InChIKey | IYMZIOPOOBFXBE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|