C5H11P — CID 59207148
(2S)-1,2-dimethylphosphetane (PubChem CID 59207148) has the molecular formula C5H11P and a molecular weight of 102.12 g/mol. Its IUPAC name is (2S)-1,2-dimethylphosphetane.
| Compound Name | (2S)-1,2-dimethylphosphetane |
|---|---|
| PubChem CID | 59207148 |
| Molecular Formula | C5H11P |
| Molecular Weight | 102.12 g/mol |
| Exact Mass | 102.06 |
| IUPAC Name | (2S)-1,2-dimethylphosphetane |
| SMILES | C[C@H]1CCP1C |
| InChI | InChI=1S/C5H11P/c1-5-3-4-6(5)2/h5H,3-4H2,1-2H3/t5-,6?/m0/s1 |
| InChIKey | NFOHFJJDUGNTBR-ZBHICJROSA-N |
| XLogP | 1.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.12 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|