C17H32P2 — CID 58698014
dicyclohexyl-[(1S,2S)-1-methylphospholan-2-yl]phosphane (PubChem CID 58698014) has the molecular formula C17H32P2 and a molecular weight of 298.39 g/mol. Its IUPAC name is dicyclohexyl-[(1S,2S)-1-methylphospholan-2-yl]phosphane.
| Compound Name | dicyclohexyl-[(1S,2S)-1-methylphospholan-2-yl]phosphane |
|---|---|
| PubChem CID | 58698014 |
| Molecular Formula | C17H32P2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | dicyclohexyl-[(1S,2S)-1-methylphospholan-2-yl]phosphane |
| SMILES | C[P@@]1CCC[C@@H]1P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H32P2/c1-18-14-8-13-17(18)19(15-9-4-2-5-10-15)16-11-6-3-7-12-16/h15-17H,2-14H2,1H3/t17-,18-/m0/s1 |
| InChIKey | PBWULSHYJSHABP-ROUUACIJSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|