C14H28P2 — CID 141074063
(2S,5S)-1-[1-[(2S,5S)-2,5-dimethylphospholan-1-yl]ethyl]-2,5-dimethylphospholane (PubChem CID 141074063) has the molecular formula C14H28P2 and a molecular weight of 258.33 g/mol. Its IUPAC name is (2S,5S)-1-[1-[(2S,5S)-2,5-dimethylphospholan-1-yl]ethyl]-2,5-dimethylphospholane.
| Compound Name | (2S,5S)-1-[1-[(2S,5S)-2,5-dimethylphospholan-1-yl]ethyl]-2,5-dimethylphospholane |
|---|---|
| PubChem CID | 141074063 |
| Molecular Formula | C14H28P2 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2S,5S)-1-[1-[(2S,5S)-2,5-dimethylphospholan-1-yl]ethyl]-2,5-dimethylphospholane |
| SMILES | CC(P1[C@@H](C)CC[C@@H]1C)P1[C@@H](C)CC[C@@H]1C |
| InChI | InChI=1S/C14H28P2/c1-10-6-7-11(2)15(10)14(5)16-12(3)8-9-13(16)4/h10-14H,6-9H2,1-5H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | XYHXIEJPQNFZED-CYDGBPFRSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|