C7H15P — CID 23279881
(3R,4S)-1,3,4-trimethylphospholane (PubChem CID 23279881) has the molecular formula C7H15P and a molecular weight of 130.17 g/mol. Its IUPAC name is (3R,4S)-1,3,4-trimethylphospholane.
| Compound Name | (3R,4S)-1,3,4-trimethylphospholane |
|---|---|
| PubChem CID | 23279881 |
| Molecular Formula | C7H15P |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | (3R,4S)-1,3,4-trimethylphospholane |
| SMILES | C[C@@H]1CP(C)C[C@@H]1C |
| InChI | InChI=1S/C7H15P/c1-6-4-8(3)5-7(6)2/h6-7H,4-5H2,1-3H3/t6-,7+,8? |
| InChIKey | HONZFQNHJDKHQI-DHBOJHSNSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|