About dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane
dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane (PubChem CID 11480571) has the molecular formula C8H17BO2
and a molecular weight of 156.03 g/mol. Its IUPAC name is dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane.
Molecular Properties
| Compound Name | dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane |
| PubChem CID | 11480571 |
| Molecular Formula | C8H17BO2 |
| Molecular Weight | 156.03 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane |
| SMILES | COB(OC)[C@@H]1CCC[C@@H]1C |
| InChI | InChI=1S/C8H17BO2/c1-7-5-4-6-8(7)9(10-2)11-3/h7-8H,4-6H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | JQVWLDGWZDLNGR-JGVFFNPUSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.03 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane?
The IUPAC name of dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane (CID 11480571) is dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane.
What is the SMILES notation for dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane?
The canonical SMILES for dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane is COB(OC)[C@@H]1CCC[C@@H]1C.
What is the InChIKey of dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane?
The InChIKey is JQVWLDGWZDLNGR-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H17BO2/c1-7-5-4-6-8(7)9(10-2)11-3/h7-8H,4-6H2,1-3H3/t7-,8+/m0/s1.
What are the key properties of dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane?
dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane has a molecular weight of 156.03 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy-[(1R,2S)-2-methylcyclopentyl]borane is sourced from PubChem (CID 11480571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).