C14H26NOP — CID 11578864
(4R)-2-[(1S,2R)-1-tert-butylphospholan-2-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 11578864) has the molecular formula C14H26NOP and a molecular weight of 255.34 g/mol. Its IUPAC name is (4R)-2-[(1S,2R)-1-tert-butylphospholan-2-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-2-[(1S,2R)-1-tert-butylphospholan-2-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 11578864 |
| Molecular Formula | C14H26NOP |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (4R)-2-[(1S,2R)-1-tert-butylphospholan-2-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)[C@@H]1COC([C@H]2CCC[P@]2C(C)(C)C)=N1 |
| InChI | InChI=1S/C14H26NOP/c1-10(2)11-9-16-13(15-11)12-7-6-8-17(12)14(3,4)5/h10-12H,6-9H2,1-5H3/t11-,12+,17-/m0/s1 |
| InChIKey | XFERVANJVPKHDQ-JKDFXYPNSA-N |
| XLogP | 3.88 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|