C46H58Cl2N2O2P2Pd+2 — CID 135024140
dichloropalladium;bis(diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]phosphanium) (PubChem CID 135024140) has the molecular formula C46H58Cl2N2O2P2Pd+2 and a molecular weight of 910.26 g/mol. Its IUPAC name is dichloropalladium;bis(diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]phosphanium).
| Compound Name | dichloropalladium;bis(diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]phosphanium) |
|---|---|
| PubChem CID | 135024140 |
| Molecular Formula | C46H58Cl2N2O2P2Pd+2 |
| Molecular Weight | 910.26 g/mol |
| Exact Mass | 908.24 |
| IUPAC Name | dichloropalladium;bis(diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]phosphanium) |
| SMILES | CC(C)[C@H]1COC(C2CCCC2[PH+](c2ccccc2)c2ccccc2)=N1.CC(C)[C@H]1COC(C2CCCC2[PH+](c2ccccc2)c2ccccc2)=N1.Cl[Pd]Cl |
| InChI | InChI=1S/2C23H28NOP.2ClH.Pd/c2*1-17(2)21-16-25-23(24-21)20-14-9-15-22(20)26(18-10-5-3-6-11-18)19-12-7-4-8-13-19;;;/h2*3-8,10-13,17,20-22H,9,14-16H2,1-2H3;2*1H;/q;;;;+2/t2*20?,21-,22?;;;/m11.../s1 |
| InChIKey | ZYRBRNVHLSCUEO-FLUWZLDBSA-N |
| XLogP | 10.32 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.26 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|