C24H29N2OP — CID 70877075
diphenyl-[3-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)-2-azabicyclo[2.2.1]heptan-2-yl]phosphane (PubChem CID 70877075) has the molecular formula C24H29N2OP and a molecular weight of 392.48 g/mol. Its IUPAC name is diphenyl-[3-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)-2-azabicyclo[2.2.1]heptan-2-yl]phosphane.
| Compound Name | diphenyl-[3-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)-2-azabicyclo[2.2.1]heptan-2-yl]phosphane |
|---|---|
| PubChem CID | 70877075 |
| Molecular Formula | C24H29N2OP |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | diphenyl-[3-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)-2-azabicyclo[2.2.1]heptan-2-yl]phosphane |
| SMILES | CC(C)C1COC(C2C3CCC(C3)N2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C24H29N2OP/c1-17(2)22-16-27-24(25-22)23-18-13-14-19(15-18)26(23)28(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,17-19,22-23H,13-16H2,1-2H3 |
| InChIKey | XKDPDTYRCCFEFG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|