C21H26NOP — CID 170897211
diphenyl-[2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]phosphane (PubChem CID 170897211) has the molecular formula C21H26NOP and a molecular weight of 339.42 g/mol. Its IUPAC name is diphenyl-[2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]phosphane.
| Compound Name | diphenyl-[2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]phosphane |
|---|---|
| PubChem CID | 170897211 |
| Molecular Formula | C21H26NOP |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | diphenyl-[2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]phosphane |
| SMILES | CC(C)[C@@H]1COC(C(C)(C)P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C21H26NOP/c1-16(2)19-15-23-20(22-19)21(3,4)24(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,19H,15H2,1-4H3/t19-/m0/s1 |
| InChIKey | ZNZFWFYCCAGUKU-IBGZPJMESA-N |
| XLogP | 4.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|