C25H26NOP — CID 170897725
2-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl-diphenylphosphane (PubChem CID 170897725) has the molecular formula C25H26NOP and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl-diphenylphosphane.
| Compound Name | 2-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl-diphenylphosphane |
|---|---|
| PubChem CID | 170897725 |
| Molecular Formula | C25H26NOP |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl-diphenylphosphane |
| SMILES | CC(C)(C1=N[C@H](Cc2ccccc2)CO1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26NOP/c1-25(2,24-26-21(19-27-24)18-20-12-6-3-7-13-20)28(22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,21H,18-19H2,1-2H3/t21-/m1/s1 |
| InChIKey | FAFDZWJVILFJKZ-OAQYLSRUSA-N |
| XLogP | 4.94 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|