C27H28NOP — CID 163196597
[2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane (PubChem CID 163196597) has the molecular formula C27H28NOP and a molecular weight of 413.50 g/mol. Its IUPAC name is [2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane.
| Compound Name | [2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane |
|---|---|
| PubChem CID | 163196597 |
| Molecular Formula | C27H28NOP |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | [2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane |
| SMILES | c1ccc(C[C@H]2COC(C3CCCC3P(c3ccccc3)c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C27H28NOP/c1-4-11-21(12-5-1)19-22-20-29-27(28-22)25-17-10-18-26(25)30(23-13-6-2-7-14-23)24-15-8-3-9-16-24/h1-9,11-16,22,25-26H,10,17-20H2/t22-,25?,26?/m0/s1 |
| InChIKey | PEVIHPACHXZYSL-OIEGUCRUSA-N |
| XLogP | 5.33 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|