C17H33P — CID 166973641
(2S)-1-(1-ethylcyclopentyl)-2,5-di(propan-2-yl)phospholane (PubChem CID 166973641) has the molecular formula C17H33P and a molecular weight of 268.42 g/mol. Its IUPAC name is (2S)-1-(1-ethylcyclopentyl)-2,5-di(propan-2-yl)phospholane.
| Compound Name | (2S)-1-(1-ethylcyclopentyl)-2,5-di(propan-2-yl)phospholane |
|---|---|
| PubChem CID | 166973641 |
| Molecular Formula | C17H33P |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | (2S)-1-(1-ethylcyclopentyl)-2,5-di(propan-2-yl)phospholane |
| SMILES | CCC1(P2C(C(C)C)CC[C@H]2C(C)C)CCCC1 |
| InChI | InChI=1S/C17H33P/c1-6-17(11-7-8-12-17)18-15(13(2)3)9-10-16(18)14(4)5/h13-16H,6-12H2,1-5H3/t15-,16?,18?/m0/s1 |
| InChIKey | ZOLGRJLUNYRWLO-HJOIGYKYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|