C26H36N4O3 — CID 123897221
3-[3-[2-(4-hydroxyphenyl)ethylamino]propanoylamino]-N-methyl-N-(2-piperidin-1-ylethyl)benzamide (PubChem CID 123897221) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is 3-[3-[2-(4-hydroxyphenyl)ethylamino]propanoylamino]-N-methyl-N-(2-piperidin-1-ylethyl)benzamide.
| Compound Name | 3-[3-[2-(4-hydroxyphenyl)ethylamino]propanoylamino]-N-methyl-N-(2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 123897221 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 3-[3-[2-(4-hydroxyphenyl)ethylamino]propanoylamino]-N-methyl-N-(2-piperidin-1-ylethyl)benzamide |
| SMILES | CN(CCN1CCCCC1)C(=O)c1cccc(NC(=O)CCNCCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C26H36N4O3/c1-29(18-19-30-16-3-2-4-17-30)26(33)22-6-5-7-23(20-22)28-25(32)13-15-27-14-12-21-8-10-24(31)11-9-21/h5-11,20,27,31H,2-4,12-19H2,1H3,(H,28,32) |
| InChIKey | LZFDMXLRWXVEOF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|