C22H36NO13P — CID 123897991
[3-(3-acetamido-4-acetyloxy-6-diethoxyphosphoryloxan-2-yl)-2,3-diacetyloxypropyl] acetate (PubChem CID 123897991) has the molecular formula C22H36NO13P and a molecular weight of 553.50 g/mol. Its IUPAC name is [3-(3-acetamido-4-acetyloxy-6-diethoxyphosphoryloxan-2-yl)-2,3-diacetyloxypropyl] acetate.
| Compound Name | [3-(3-acetamido-4-acetyloxy-6-diethoxyphosphoryloxan-2-yl)-2,3-diacetyloxypropyl] acetate |
|---|---|
| PubChem CID | 123897991 |
| Molecular Formula | C22H36NO13P |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | [3-(3-acetamido-4-acetyloxy-6-diethoxyphosphoryloxan-2-yl)-2,3-diacetyloxypropyl] acetate |
| SMILES | CCOP(=O)(OCC)C1CC(OC(C)=O)C(NC(C)=O)C(C(OC(C)=O)C(COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C22H36NO13P/c1-8-31-37(29,32-9-2)19-10-17(33-14(5)26)20(23-12(3)24)22(36-19)21(35-16(7)28)18(34-15(6)27)11-30-13(4)25/h17-22H,8-11H2,1-7H3,(H,23,24) |
| InChIKey | CKAUYFNPDWRENM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|