About S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate
S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate (PubChem CID 123902313) has the molecular formula C10H14O2S
and a molecular weight of 198.29 g/mol. Its IUPAC name is S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate.
Molecular Properties
| Compound Name | S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate |
| PubChem CID | 123902313 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1=CCCC=C1CO |
| InChI | InChI=1S/C10H14O2S/c1-8(12)13-7-10-5-3-2-4-9(10)6-11/h4-5,11H,2-3,6-7H2,1H3 |
| InChIKey | WLIRTZWFYGFPRV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate?
The IUPAC name of S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate (CID 123902313) is S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate.
What is the SMILES notation for S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate?
The canonical SMILES for S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate is CC(=O)SCC1=CCCC=C1CO.
What is the InChIKey of S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate?
The InChIKey is WLIRTZWFYGFPRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2S/c1-8(12)13-7-10-5-3-2-4-9(10)6-11/h4-5,11H,2-3,6-7H2,1H3.
What are the key properties of S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate?
S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate has a molecular weight of 198.29 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[[6-(hydroxymethyl)cyclohexa-1,5-dien-1-yl]methyl] ethanethioate is sourced from PubChem (CID 123902313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).