C12H14OS — CID 144526898
(3-methylsulfanyl-6,7-dihydronaphthalen-2-yl)methanol (PubChem CID 144526898) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is (3-methylsulfanyl-6,7-dihydronaphthalen-2-yl)methanol.
| Compound Name | (3-methylsulfanyl-6,7-dihydronaphthalen-2-yl)methanol |
|---|---|
| PubChem CID | 144526898 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (3-methylsulfanyl-6,7-dihydronaphthalen-2-yl)methanol |
| SMILES | CSc1cc2c(cc1CO)=CCCC=2 |
| InChI | InChI=1S/C12H14OS/c1-14-12-7-10-5-3-2-4-9(10)6-11(12)8-13/h4-7,13H,2-3,8H2,1H3 |
| InChIKey | HHNDCOOURHFQGR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |