C14H22OS — CID 123978448
5,7-dimethyl-2-methylsulfanyl-4-prop-1-en-2-ylocta-2,4,6-trien-1-ol (PubChem CID 123978448) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is 5,7-dimethyl-2-methylsulfanyl-4-prop-1-en-2-ylocta-2,4,6-trien-1-ol.
| Compound Name | 5,7-dimethyl-2-methylsulfanyl-4-prop-1-en-2-ylocta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 123978448 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 5,7-dimethyl-2-methylsulfanyl-4-prop-1-en-2-ylocta-2,4,6-trien-1-ol |
| SMILES | C=C(C)C(C=C(CO)SC)=C(C)C=C(C)C |
| InChI | InChI=1S/C14H22OS/c1-10(2)7-12(5)14(11(3)4)8-13(9-15)16-6/h7-8,15H,3,9H2,1-2,4-6H3 |
| InChIKey | SGDAYGWYAMORAI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|