C13H24OS — CID 123680401
3,7-dimethyl-8-propylsulfanylocta-2,6-dien-1-ol (PubChem CID 123680401) has the molecular formula C13H24OS and a molecular weight of 228.40 g/mol. Its IUPAC name is 3,7-dimethyl-8-propylsulfanylocta-2,6-dien-1-ol.
| Compound Name | 3,7-dimethyl-8-propylsulfanylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 123680401 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3,7-dimethyl-8-propylsulfanylocta-2,6-dien-1-ol |
| SMILES | CCCSCC(C)=CCCC(C)=CCO |
| InChI | InChI=1S/C13H24OS/c1-4-10-15-11-13(3)7-5-6-12(2)8-9-14/h7-8,14H,4-6,9-11H2,1-3H3 |
| InChIKey | SUZUXNNHQLSCTC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|