C10H18OS — CID 143477948
2-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]sulfanylethanol (PubChem CID 143477948) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is 2-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]sulfanylethanol.
| Compound Name | 2-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]sulfanylethanol |
|---|---|
| PubChem CID | 143477948 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 2-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]sulfanylethanol |
| SMILES | CC/C(C)=C\C=C(/C)SCCO |
| InChI | InChI=1S/C10H18OS/c1-4-9(2)5-6-10(3)12-8-7-11/h5-6,11H,4,7-8H2,1-3H3/b9-5-,10-6+ |
| InChIKey | OPLIIBAFKARRGE-VTBWALSUSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|