C11H20S — CID 142123449
(3E)-3-methyl-7-methylsulfanylnona-3,5-diene (PubChem CID 142123449) has the molecular formula C11H20S and a molecular weight of 184.35 g/mol. Its IUPAC name is (3E)-3-methyl-7-methylsulfanylnona-3,5-diene.
| Compound Name | (3E)-3-methyl-7-methylsulfanylnona-3,5-diene |
|---|---|
| PubChem CID | 142123449 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (3E)-3-methyl-7-methylsulfanylnona-3,5-diene |
| SMILES | CC/C(C)=C/C=CC(CC)SC |
| InChI | InChI=1S/C11H20S/c1-5-10(3)8-7-9-11(6-2)12-4/h7-9,11H,5-6H2,1-4H3/b9-7?,10-8+ |
| InChIKey | BNDVXFUJTXLMAY-LSVQJBSPSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|