C8H14S2 — CID 123802058
5-(methyldisulfanyl)hepta-1,3-diene (PubChem CID 123802058) has the molecular formula C8H14S2 and a molecular weight of 174.33 g/mol. Its IUPAC name is 5-(methyldisulfanyl)hepta-1,3-diene.
| Compound Name | 5-(methyldisulfanyl)hepta-1,3-diene |
|---|---|
| PubChem CID | 123802058 |
| Molecular Formula | C8H14S2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 5-(methyldisulfanyl)hepta-1,3-diene |
| SMILES | C=CC=CC(CC)SSC |
| InChI | InChI=1S/C8H14S2/c1-4-6-7-8(5-2)10-9-3/h4,6-8H,1,5H2,2-3H3 |
| InChIKey | BHPIDCWLPIIKEL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|