C9H13F3O — CID 154026455
(2E,4Z)-5-methyl-2-(trifluoromethoxy)hepta-2,4-diene (PubChem CID 154026455) has the molecular formula C9H13F3O and a molecular weight of 194.20 g/mol. Its IUPAC name is (2E,4Z)-5-methyl-2-(trifluoromethoxy)hepta-2,4-diene.
| Compound Name | (2E,4Z)-5-methyl-2-(trifluoromethoxy)hepta-2,4-diene |
|---|---|
| PubChem CID | 154026455 |
| Molecular Formula | C9H13F3O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (2E,4Z)-5-methyl-2-(trifluoromethoxy)hepta-2,4-diene |
| SMILES | CC/C(C)=C\C=C(/C)OC(F)(F)F |
| InChI | InChI=1S/C9H13F3O/c1-4-7(2)5-6-8(3)13-9(10,11)12/h5-6H,4H2,1-3H3/b7-5-,8-6+ |
| InChIKey | DQEDDHHUEANWLY-CGXWXWIYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|