C11H18O2 — CID 143183201
(1E,3E,5E)-3-ethoxy-6-methylocta-1,3,5-trien-1-ol (PubChem CID 143183201) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (1E,3E,5E)-3-ethoxy-6-methylocta-1,3,5-trien-1-ol.
| Compound Name | (1E,3E,5E)-3-ethoxy-6-methylocta-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 143183201 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (1E,3E,5E)-3-ethoxy-6-methylocta-1,3,5-trien-1-ol |
| SMILES | CCOC(/C=C/O)=C/C=C(\C)CC |
| InChI | InChI=1S/C11H18O2/c1-4-10(3)6-7-11(8-9-12)13-5-2/h6-9,12H,4-5H2,1-3H3/b9-8+,10-6+,11-7+ |
| InChIKey | UTCDHJKFNWDLFF-YSTBUFFTSA-N |
| XLogP | 3.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|